cas: 179816-26-3 — see every product listed under this CAS number, including other names
2-Fluoro-3-nitrophenol, 97%, 97% (CAS 179816-26-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1138AB-100mg |
| cas | 179816-26-3 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 664.40 Pln | |
| Chemat | 25g | 2118.80 Pln | |
| Chemat | 10g | 1110.80 Pln | |
| Chemat | 250g | 14819.60 Pln | |
| Chemat | 500g | 28185.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-3-nitrophenol (CAS 179816-26-3) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 2-fluoro-3-nitrophenol. InChIKey: QZOGSUCWBIPKDC-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 2-fluoro-3-nitrophenol |
| InChIKey | QZOGSUCWBIPKDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)