cas: 179816-26-3 — see every product listed under this CAS number, including other names
2-Fluoro-3-nitrophenol, 98% (CAS 179816-26-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077045-5G |
| cas | 179816-26-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 877.83 Pln | |
| Fluorochem | 10g | 1684.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-fluoro-3-nitrophenol (CAS 179816-26-3) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 2-fluoro-3-nitrophenol. InChIKey: QZOGSUCWBIPKDC-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 2-fluoro-3-nitrophenol |
| InChIKey | QZOGSUCWBIPKDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)