cas: 1125394-25-3 — see every product listed under this CAS number, including other names
2-Fluoro-4,5-dimethylphenylboronic acid (CAS 1125394-25-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628019-250MG |
| cas | 1125394-25-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 6537.30 Pln | |
| Fluorochem | 500mg | 7417.20 Pln |
| delivery time | 3-4 weeks |
|---|
(2-fluoro-4,5-dimethylphenyl)boronic acid (CAS 1125394-25-3) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (2-fluoro-4,5-dimethylphenyl)boronic acid. InChIKey: AOHOANSNSRDDMO-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (2-fluoro-4,5-dimethylphenyl)boronic acid |
| InChIKey | AOHOANSNSRDDMO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)C)C)(O)O |
Computed by PubChem (NCBI)