CAS 864759-65-9 is the registry number for 3,4-Dimethyl-5-fluoro-phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(3-fluoro-4,5-dimethylphenyl)boronic acid (CAS 864759-65-9) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (3-fluoro-4,5-dimethylphenyl)boronic acid. InChIKey: FLXJTRXIQNTPMG-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (3-fluoro-4,5-dimethylphenyl)boronic acid |
| InChIKey | FLXJTRXIQNTPMG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C)C)(O)O |
Computed by PubChem (NCBI)