Products 211495-31-7

CAS 211495-31-7 is the registry number for 4-Fluoro-2,3-dimethylphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(4-fluoro-2,3-dimethylphenyl)boronic acid (CAS 211495-31-7) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (4-fluoro-2,3-dimethylphenyl)boronic acid. InChIKey: JACGHVGDEQRIFL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BFO2
Molecular weight167.98 g/mol
IUPAC name(4-fluoro-2,3-dimethylphenyl)boronic acid
InChIKeyJACGHVGDEQRIFL-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)F)C)C)(O)O

Computed by PubChem (NCBI)