CAS 211495-31-7 is the registry number for 4-Fluoro-2,3-dimethylphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
(4-fluoro-2,3-dimethylphenyl)boronic acid (CAS 211495-31-7) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (4-fluoro-2,3-dimethylphenyl)boronic acid. InChIKey: JACGHVGDEQRIFL-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (4-fluoro-2,3-dimethylphenyl)boronic acid |
| InChIKey | JACGHVGDEQRIFL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)C)C)(O)O |
Computed by PubChem (NCBI)