CAS 762286-31-7 is the registry number for 3-Fluoro-2,4-dimethylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
(3-fluoro-2,4-dimethylphenyl)boronic acid (CAS 762286-31-7) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (3-fluoro-2,4-dimethylphenyl)boronic acid. InChIKey: WVMGJPPIHJAPAG-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (3-fluoro-2,4-dimethylphenyl)boronic acid |
| InChIKey | WVMGJPPIHJAPAG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)F)C)(O)O |
Computed by PubChem (NCBI)