CAS 1072946-10-1 appears in our catalog under these names: 4-Fluoro-2,5-dimethylphenylboronic acid, 98%, (4-Fluoro-2,5-dimethylphenyl)boronic acid, 98%, 4-Fluoro-2,5-dimethylphenylboronic acid, ≥95%, ≥95%, 4-Fluoro-2,5-dimethylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
(4-fluoro-2,5-dimethylphenyl)boronic acid (CAS 1072946-10-1) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (4-fluoro-2,5-dimethylphenyl)boronic acid. InChIKey: VZEWNOKICGAJPJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (4-fluoro-2,5-dimethylphenyl)boronic acid |
| InChIKey | VZEWNOKICGAJPJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)C)(O)O |
Computed by PubChem (NCBI)