CAS 1125394-25-3 appears in our catalog under these names: 2-Fluoro-4,5-dimethylphenylboronic acid, 95%, 2-Fluoro-4,5-dimethylphenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg.
(2-fluoro-4,5-dimethylphenyl)boronic acid (CAS 1125394-25-3) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (2-fluoro-4,5-dimethylphenyl)boronic acid. InChIKey: AOHOANSNSRDDMO-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (2-fluoro-4,5-dimethylphenyl)boronic acid |
| InChIKey | AOHOANSNSRDDMO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)C)C)(O)O |
Computed by PubChem (NCBI)