cas: 207853-64-3 — see every product listed under this CAS number, including other names
2-Fluoro-4-(trifluoromethyl)benzamide 98% (CAS 207853-64-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A353787-1g |
| cas | 207853-64-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 1249.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A353787 |
2-fluoro-4-(trifluoromethyl)benzamide (CAS 207853-64-3) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethyl)benzamide. InChIKey: BQNZIRSNAKWERJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethyl)benzamide |
| InChIKey | BQNZIRSNAKWERJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)C(=O)N |
Computed by PubChem (NCBI)