cas: 207981-46-2 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethyl)benzoyl Chloride, >98.0%(T) (CAS 207981-46-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0764-5G |
| cas | 207981-46-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 670.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2-fluoro-5-(trifluoromethyl)benzoyl chloride (CAS 207981-46-2) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethyl)benzoyl chloride. InChIKey: OFVKAIZITGCCDN-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | OFVKAIZITGCCDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)F |
Computed by PubChem (NCBI)