cas: 22510-08-3 — see every product listed under this CAS number, including other names
2-Fluoro-5-nitrophenol 98% (CAS 22510-08-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A348054-250mg |
| cas | 22510-08-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 437.12 Pln | |
| Ambeed | 100g | 1532.94 Pln | |
| Ambeed | 500g | 7067.62 Pln | |
| Ambeed | 1000g | 14054.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A348054 |
2-fluoro-5-nitrophenol (CAS 22510-08-3) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 2-fluoro-5-nitrophenol. InChIKey: WFRLFZAMCVAQLN-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 2-fluoro-5-nitrophenol |
| InChIKey | WFRLFZAMCVAQLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)F |
Computed by PubChem (NCBI)