CAS 22510-08-3 appears in our catalog under these names: 2–Fluoro–5–nitrophenol, 2-Fluoro-5-nitrophenol 98%, 2-Fluoro-5-nitrophenol, 98%, 98%, 2-Fluoro-5-nitrophenol, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g, 500g, 1000g.
2-fluoro-5-nitrophenol (CAS 22510-08-3) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 2-fluoro-5-nitrophenol. InChIKey: WFRLFZAMCVAQLN-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 2-fluoro-5-nitrophenol |
| InChIKey | WFRLFZAMCVAQLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)F |
Computed by PubChem (NCBI)