2-Fluoro-DL-mandelic Acid, 97%, 97%
cas: 389-31-1 — see every product listed under this CAS number, including other names
2-Fluoro-DL-mandelic Acid, 97%, 97% (CAS 389-31-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HBY-100mg |
| cas | 389-31-1 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 434.00 Pln | |
| Chemat | 25g | 1312.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-fluorophenyl)-2-hydroxyacetic acid (CAS 389-31-1) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-(2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: WWSRHIZZWWDONI-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | WWSRHIZZWWDONI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-DL-mandelic Acid, 2-Fluoromandelic acid, 2-(2-fluorophenyl)-2-hydroxyacetic acid, o-fluoromandelic acid, 2-Fluoro-DL-mandelicAcid, (2-fluorophenyl)(hydroxy)acetic acid, 2-(2-fluorophenyl)-2-hydroxy-acetic Acid, 2-Fluoromandelic acid, AldrichCPR, acetic acid, 2-(2-fluorophenyl)-2-hydroxy-