cas: 389-31-1 — see every product listed under this CAS number, including other names
2-Fluoromandelic acid 95% (CAS 389-31-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A907294-250mg |
| cas | 389-31-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 576.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A907294 |
2-(2-fluorophenyl)-2-hydroxyacetic acid (CAS 389-31-1) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-(2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: WWSRHIZZWWDONI-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | WWSRHIZZWWDONI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)F |
Computed by PubChem (NCBI)