2-Iodo-4-nitro-1H-indole, 97%
cas: 1935958-72-7 — see every product listed under this CAS number, including other names
2-Iodo-4-nitro-1H-indole, 97% (CAS 1935958-72-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A591987-250mg |
| cas | 1935958-72-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 581.75 Pln | |
| Ambeed | 5g | 2111.44 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 625.36 Pln | |
| BLDpharm | 5g | 2274.78 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1994.00 Pln | |
| Chemat | 25g | 4749.20 Pln | |
| Fluorochem | 1g | 555.03 Pln | |
| Fluorochem | 5g | 2075.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-iodo-4-nitro-1H-indole (CAS 1935958-72-7) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 2-iodo-4-nitro-1H-indole. InChIKey: WREYKHIFQJRJMS-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 2-iodo-4-nitro-1H-indole |
| InChIKey | WREYKHIFQJRJMS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(N2)I)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)