cas: 13906-09-7 — see every product listed under this CAS number, including other names
2-Mercaptoquinazolin-4(3H)-one, 97%, 97% (CAS 13906-09-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112A4S-100mg |
| cas | 13906-09-7 |
| size | 100mg |
| availability | 75.15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 25g | 837.20 Pln | |
| Chemat | 50g | 1542.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-sulfanylidene-1H-quinazolin-4-one (CAS 13906-09-7) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 2-sulfanylidene-1H-quinazolin-4-one. InChIKey: PUPFOFVEHDNUJU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | PUPFOFVEHDNUJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=S)N2 |
Computed by PubChem (NCBI)