cas: 13906-09-7 — see every product listed under this CAS number, including other names
2-mercaptoquinazolin-4(3H)-one, 97% (CAS 13906-09-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F372226-1G |
| cas | 13906-09-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 466.52 Pln | |
| Fluorochem | 10g | 726.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-sulfanylidene-1H-quinazolin-4-one (CAS 13906-09-7) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 2-sulfanylidene-1H-quinazolin-4-one. InChIKey: PUPFOFVEHDNUJU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | PUPFOFVEHDNUJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=S)N2 |
Computed by PubChem (NCBI)