cas: 63628-25-1 — see every product listed under this CAS number, including other names
2-Methoxy-2-(1-naphthyl)propionic Acid, >98.0%(GC)(T) (CAS 63628-25-1) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M1368-5G |
| cas | 63628-25-1 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 4470.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-methoxy-2-naphthalen-1-ylpropanoic acid (CAS 63628-25-1) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 2-methoxy-2-naphthalen-1-ylpropanoic acid. InChIKey: YVWMPILNFZOQSZ-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-methoxy-2-naphthalen-1-ylpropanoic acid |
| InChIKey | YVWMPILNFZOQSZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=CC=CC=C21)(C(=O)O)OC |
Computed by PubChem (NCBI)