cas: 1356638-77-1 — see every product listed under this CAS number, including other names
2-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 96% (CAS 1356638-77-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A577396-250mg |
| cas | 1356638-77-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1510.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A577396 |
2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1356638-77-1) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: SYGGRAHIRANTMJ-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | SYGGRAHIRANTMJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C=O)OC |
Computed by PubChem (NCBI)