cas: 453560-74-2 — see every product listed under this CAS number, including other names
2-Methoxy-4-nitro-1-(trifluoromethyl)benzene 95% (CAS 453560-74-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323949-1g |
| cas | 453560-74-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1583.00 Pln | |
| Ambeed | 25g | 7106.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A323949 |
2-methoxy-4-nitro-1-(trifluoromethyl)benzene (CAS 453560-74-2) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 2-methoxy-4-nitro-1-(trifluoromethyl)benzene. InChIKey: UDEARCRKLPPYAU-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 2-methoxy-4-nitro-1-(trifluoromethyl)benzene |
| InChIKey | UDEARCRKLPPYAU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)