2-Methoxy-6-(trifluoromethyl)isonicotinic acid, 98%
cas: 1227581-20-5 — see every product listed under this CAS number, including other names
2-Methoxy-6-(trifluoromethyl)isonicotinic acid, 98% (CAS 1227581-20-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A445513-250mg |
| cas | 1227581-20-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Ambeed | 5g | 4720.25 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1730.53 Pln | |
| BLDpharm | 5g | 5084.90 Pln | |
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 3007.29 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1227581-20-5) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: KLQHNZRQGMJSRK-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | KLQHNZRQGMJSRK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)