cas: 1227581-20-5 — see every product listed under this CAS number, including other names
2-Methoxy-6-trifluoromethyl-isonicotinic acid, 98%, 98% (CAS 1227581-20-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JBM-5g |
| cas | 1227581-20-5 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 3592.40 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1230.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1227581-20-5) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: KLQHNZRQGMJSRK-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | KLQHNZRQGMJSRK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)