cas: 1514864-84-6 — see every product listed under this CAS number, including other names
2-Methoxy-9,9-dimethyl-9H-fluorene, 98%, 98% (CAS 1514864-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JQUS-100mg |
| cas | 1514864-84-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 150.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-9,9-dimethylfluorene (CAS 1514864-84-6) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 2-methoxy-9,9-dimethylfluorene. InChIKey: ZWBHUKZFZLEKKA-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 2-methoxy-9,9-dimethylfluorene |
| InChIKey | ZWBHUKZFZLEKKA-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)OC)C |
Computed by PubChem (NCBI)