2-Methyl-1,10-phenanthroline, 98%
cas: 3002-77-5 — see every product listed under this CAS number, including other names
2-Methyl-1,10-phenanthroline, 98% (CAS 3002-77-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A789785-100mg |
| cas | 3002-77-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1260.38 Pln | |
| Ambeed | 25g | 4119.50 Pln | |
| Ambeed | 100g | 13025.06 Pln | |
| BLDpharm | 100mg | 131.09 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 1352.88 Pln | |
| BLDpharm | 25g | 4435.13 Pln | |
| BLDpharm | 100g | 14037.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-methyl-1,10-phenanthroline (CAS 3002-77-5) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-methyl-1,10-phenanthroline. InChIKey: LQZDYPHFVGRHKD-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-methyl-1,10-phenanthroline |
| InChIKey | LQZDYPHFVGRHKD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC3=C2N=CC=C3 |
Computed by PubChem (NCBI)