cas: 109812-64-8 — see every product listed under this CAS number, including other names
2-Methyl-1,5-diphenyl-1H-pyrrole-3-carboxylic acid, 97% (CAS 109812-64-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | SP00294DA |
| cas | 109812-64-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 386.90 Pln | |
| Thermo Scientific | 5g | 717.80 Pln | |
| Thermo Scientific | 10g | 1084.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-methyl-1,5-diphenylpyrrole-3-carboxylic acid (CAS 109812-64-8) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 2-methyl-1,5-diphenylpyrrole-3-carboxylic acid. InChIKey: DWIYTBRYOQDHTE-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 2-methyl-1,5-diphenylpyrrole-3-carboxylic acid |
| InChIKey | DWIYTBRYOQDHTE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)