CAS 1820711-54-3 appears in our catalog under these names: 6-(1-Naphthylamino)-1,4-benzodioxane, 95%, 6–(1–Naphthylamino)–1,4–benzodioxane, N-(naphthalen-1-yl)-2,3-dihydrobenzo[b][1,4]dioxin-6-amine, ≥97%, ≥97%, 6-(1-NAPHTHYLAMINO)-1,4-BENZODIOXANE, ≥97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 250mg.
N-naphthalen-1-yl-2,3-dihydro-1,4-benzodioxin-6-amine (CAS 1820711-54-3) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: N-naphthalen-1-yl-2,3-dihydro-1,4-benzodioxin-6-amine. InChIKey: WFXOBCJXPSQWNH-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | N-naphthalen-1-yl-2,3-dihydro-1,4-benzodioxin-6-amine |
| InChIKey | WFXOBCJXPSQWNH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)NC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)