CAS 855165-44-5 appears in our catalog under these names: 6,7-Dimethyl-2-phenylquinoline-4-carboxylic acid, 95%, 6,7-Dimethyl-2-phenylquinoline-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
6,7-dimethyl-2-phenylquinoline-4-carboxylic acid (CAS 855165-44-5) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 6,7-dimethyl-2-phenylquinoline-4-carboxylic acid. InChIKey: KQUUINXPEWKGQO-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 6,7-dimethyl-2-phenylquinoline-4-carboxylic acid |
| InChIKey | KQUUINXPEWKGQO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(C=C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)