CAS 899011-50-8 is the registry number for 3,8-Dimethyl-2-phenylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,8-dimethyl-2-phenylquinoline-4-carboxylic acid (CAS 899011-50-8) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 3,8-dimethyl-2-phenylquinoline-4-carboxylic acid. InChIKey: LAGXAKIJSYQAOP-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 3,8-dimethyl-2-phenylquinoline-4-carboxylic acid |
| InChIKey | LAGXAKIJSYQAOP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(C(=N2)C3=CC=CC=C3)C)C(=O)O |
Computed by PubChem (NCBI)