CAS 153813-68-4 is the registry number for 2-[(E)-2-(Dimethylamino)ethenyl]-9,10-dihydroanthracene-9,10-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[(E)-2-(dimethylamino)ethenyl]anthracene-9,10-dione (CAS 153813-68-4) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 2-[(E)-2-(dimethylamino)ethenyl]anthracene-9,10-dione. InChIKey: BRXNFBXZMAJSSI-MDZDMXLPSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 2-[(E)-2-(dimethylamino)ethenyl]anthracene-9,10-dione |
| InChIKey | BRXNFBXZMAJSSI-MDZDMXLPSA-N |
| SMILES | CN(C)/C=C/C1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)