Products 109812-64-8
CAS 109812-64-8 appears in our catalog under these names: 2-Methyl-1,5-diphenyl-1h-pyrrole-3-carboxylic acid, 95%, 2-Methyl-1,5-diphenyl-1H-pyrrole-3-carboxylic acid, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 5g, 10g, 1g.
2-methyl-1,5-diphenylpyrrole-3-carboxylic acid (CAS 109812-64-8) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 2-methyl-1,5-diphenylpyrrole-3-carboxylic acid. InChIKey: DWIYTBRYOQDHTE-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 2-methyl-1,5-diphenylpyrrole-3-carboxylic acid |
| InChIKey | DWIYTBRYOQDHTE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)