2-Methyl-3-(trifluoromethyl)phenylboronic acid, 98%
cas: 947533-86-0 — see every product listed under this CAS number, including other names
2-Methyl-3-(trifluoromethyl)phenylboronic acid, 98% (CAS 947533-86-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225334-1G |
| cas | 947533-86-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 1028.82 Pln | |
| Fluorochem | 10g | 1565.09 Pln | |
| Fluorochem | 25g | 3142.66 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[2-methyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 947533-86-0) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [2-methyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: GCYGREFYJFYOII-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [2-methyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GCYGREFYJFYOII-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)