2-Methyl-3-oxo-3-(phenylamino)propanoic acid, 95%
cas: 15601-92-0 — see every product listed under this CAS number, including other names
2-Methyl-3-oxo-3-(phenylamino)propanoic acid, 95% (CAS 15601-92-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F864531-100MG |
| cas | 15601-92-0 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 669.57 Pln | |
| Fluorochem | 1g | 1653.60 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1139.60 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 914.15 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3-anilino-2-methyl-3-oxopropanoic acid (CAS 15601-92-0) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 3-anilino-2-methyl-3-oxopropanoic acid. InChIKey: QBCURMALTJZCPZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-anilino-2-methyl-3-oxopropanoic acid |
| InChIKey | QBCURMALTJZCPZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)