Products 665053-88-3
CAS 665053-88-3 appears in our catalog under these names: 2-((3,4-Dimethylphenyl)amino)-2-oxoacetic acid, 95%, N -(3,4-Dimethyl-phenyl)-oxalamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g.
2-(3,4-dimethylanilino)-2-oxoacetic acid (CAS 665053-88-3) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(3,4-dimethylanilino)-2-oxoacetic acid. InChIKey: ZMFFOCUQQRAQOR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-(3,4-dimethylanilino)-2-oxoacetic acid |
| InChIKey | ZMFFOCUQQRAQOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
[(3,4-dimethylphenyl)carbamoyl]formic acid, ((3,4-Dimethylphenyl)carbamoyl)formic acid, 2-((3,4-Dimethylphenyl)amino)-2-oxoacetic acid, N-(3,4-Dimethyl-phenyl)-oxalamic acid, N -(3,4-Dimethyl-phenyl)-oxalamic acid, 2-(3,4-dimethylanilino)-2-oxoacetic acid, 2-[(3,4-Dimethylphenyl)amino]-2-oxoacetic Acid, [(3,4-dimethylphenyl)amino](oxo)acetic acid, N-(3,4-Dimethylphenyl)oxalamic acid, 2-(3,4-dimethylanilino)-2-oxo-acetic acid