Products 189063-57-8
CAS 189063-57-8 appears in our catalog under these names: Methyl 4-acetyl-2-aminobenzoate, 95%, Methyl 4-acetyl-2-aminobenzoate, 98%, Methyl 4-acetyl-2-aminobenzoate, 97%, 97%, METHYL 4-ACETYL-2-AMINOBENZOATE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 50mg, 100mg.
Methyl 4-acetyl-2-aminobenzoate (CAS 189063-57-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: methyl 4-acetyl-2-aminobenzoate. InChIKey: UHXUFAOTGWYTTA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | methyl 4-acetyl-2-aminobenzoate |
| InChIKey | UHXUFAOTGWYTTA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C(=O)OC)N |
Computed by PubChem (NCBI)