CAS 23659-88-3 appears in our catalog under these names: 4,6-Dimethoxyindolin-2-one, 95%, 4,6-Dimethoxyindolin-2-one, 98%, 4,6–Dimethoxyindolin–2–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
4,6-dimethoxy-1,3-dihydroindol-2-one (CAS 23659-88-3) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 4,6-dimethoxy-1,3-dihydroindol-2-one. InChIKey: YIUOAHBKKSGOOV-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 4,6-dimethoxy-1,3-dihydroindol-2-one |
| InChIKey | YIUOAHBKKSGOOV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)N2)C(=C1)OC |
Computed by PubChem (NCBI)