Products 58781-08-1
CAS 58781-08-1 appears in our catalog under these names: 4-Oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylic acid, 95%, 4–Oxo–1，4，5，6，7，8–hexahydroquinoline–3–carboxylic acid, 4-Oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxylic acid (CAS 58781-08-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 4-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxylic acid. InChIKey: XXPUUIQPWKBEJW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 4-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxylic acid |
| InChIKey | XXPUUIQPWKBEJW-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)