CAS 103204-70-2 appears in our catalog under these names: 5-Acetamido-2-methylbenzoic acid, 5-Acetamido-2-methylbenzoic acid, 96%, 5-Acetamido-2-methylbenzoic acid, 98%, 5-Acetamido-2-methylbenzoic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 500mg, 2.5g, 100mg.
5-acetamido-2-methylbenzoic acid (CAS 103204-70-2) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 5-acetamido-2-methylbenzoic acid. InChIKey: JWEWTGQYHKEENE-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 5-acetamido-2-methylbenzoic acid |
| InChIKey | JWEWTGQYHKEENE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)