cas: 13073-29-5 — see every product listed under this CAS number, including other names
2-Methyl-6-nitrophenol 98% (CAS 13073-29-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100980-1g |
| cas | 13073-29-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 25g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100980 |
2-methyl-6-nitrophenol (CAS 13073-29-5) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-6-nitrophenol. InChIKey: AQDKZPFDOWHRDZ-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-6-nitrophenol |
| InChIKey | AQDKZPFDOWHRDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)