cas: 29196-15-4 — see every product listed under this CAS number, including other names
2-Methylquinoline-4-carbonitrile, 98%, 98% (CAS 29196-15-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113XNK-50mg |
| cas | 29196-15-4 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 251.60 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 1g | 1816.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methylquinoline-4-carbonitrile (CAS 29196-15-4) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 2-methylquinoline-4-carbonitrile. InChIKey: BQAMFFZNQIMHJG-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 2-methylquinoline-4-carbonitrile |
| InChIKey | BQAMFFZNQIMHJG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1)C#N |
Computed by PubChem (NCBI)