cas: 259809-78-4 — see every product listed under this CAS number, including other names
2-Methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyriMidine -6-carboxylic acid tert-butyl ester, 97%, 97% (CAS 259809-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BI27-100mg |
| cas | 259809-78-4 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 261.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CAS 259809-78-4) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: tert-butyl 2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate. InChIKey: DFPYVWSMGRQYCN-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | tert-butyl 2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| InChIKey | DFPYVWSMGRQYCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NC(=NC=C2C1)SC |
Computed by PubChem (NCBI)