cas: 259809-78-4 — see every product listed under this CAS number, including other names
tert-Butyl 2-(methylthio)-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate, 97% (CAS 259809-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F613675-100MG |
| cas | 259809-78-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 1174.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CAS 259809-78-4) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: tert-butyl 2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate. InChIKey: DFPYVWSMGRQYCN-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | tert-butyl 2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| InChIKey | DFPYVWSMGRQYCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NC(=NC=C2C1)SC |
Computed by PubChem (NCBI)