2-Naphthyl acrylate, 90%
cas: 52684-34-1 — see every product listed under this CAS number, including other names
2-Naphthyl acrylate, 90% (CAS 52684-34-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A392533-250mg |
| cas | 52684-34-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 25g | 1188.06 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 25g | 1110.80 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
Naphthalen-2-yl prop-2-enoate (CAS 52684-34-1) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: naphthalen-2-yl prop-2-enoate. InChIKey: SLVJUZOHXPZVLR-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | naphthalen-2-yl prop-2-enoate |
| InChIKey | SLVJUZOHXPZVLR-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)