CAS 35664-67-6 appears in our catalog under these names: 2-Formyl-5-phenylphenol, 96%, 2-Formyl-5-phenylphenol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g.
2-hydroxy-4-phenylbenzaldehyde (CAS 35664-67-6) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 2-hydroxy-4-phenylbenzaldehyde. InChIKey: PQPFIHPHEGDBQE-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-hydroxy-4-phenylbenzaldehyde |
| InChIKey | PQPFIHPHEGDBQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C=O)O |
Computed by PubChem (NCBI)