CAS 14562-10-8 appears in our catalog under these names: 2-Formyl-6-phenylphenol, 95%, 2–Hydroxy–(1,1'–biphenyl)–3–carbaldehyde, 2-Hydroxy-[1,1'-biphenyl]-3-carbaldehyde 95%, 2-Hydroxy-[1,1'-biphenyl]-3-carbaldehyde, 95%, 95%, 2-Hydroxy-[1,1'-biphenyl]-3-carbaldehyde, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-hydroxy-3-phenylbenzaldehyde (CAS 14562-10-8) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 2-hydroxy-3-phenylbenzaldehyde. InChIKey: IKYDTCFKUJZPPO-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-hydroxy-3-phenylbenzaldehyde |
| InChIKey | IKYDTCFKUJZPPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2O)C=O |
Computed by PubChem (NCBI)