CAS 86607-82-1 is the registry number for 2-Dibenzofuranmethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Dibenzofuran-2-ylmethanol (CAS 86607-82-1) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: dibenzofuran-2-ylmethanol. InChIKey: ZMBVDFRNENAAKX-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | dibenzofuran-2-ylmethanol |
| InChIKey | ZMBVDFRNENAAKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)CO |
Computed by PubChem (NCBI)