CAS 20357-70-4 appears in our catalog under these names: 2-Methoxydibenzofuran, 95%, 4-Methoxy-8-oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 0,5g.
2-methoxydibenzofuran (CAS 20357-70-4) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 2-methoxydibenzofuran. InChIKey: XSIBNFRLWPYZRA-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-methoxydibenzofuran |
| InChIKey | XSIBNFRLWPYZRA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC3=CC=CC=C32 |
Computed by PubChem (NCBI)