CAS 400745-17-7 is the registry number for 3-(3-Formylphenyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(3-hydroxyphenyl)benzaldehyde (CAS 400745-17-7) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 3-(3-hydroxyphenyl)benzaldehyde. InChIKey: MFZQXRUPOBECBS-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)benzaldehyde |
| InChIKey | MFZQXRUPOBECBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)O)C=O |
Computed by PubChem (NCBI)