cas: 133605-27-3 — see every product listed under this CAS number, including other names
2-Nitro-4-(trifluoromethyl)benzyl alcohol, 95+%, 95+% (CAS 133605-27-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118N9G-1g |
| cas | 133605-27-3 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 376.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
[2-nitro-4-(trifluoromethyl)phenyl]methanol (CAS 133605-27-3) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: [2-nitro-4-(trifluoromethyl)phenyl]methanol. InChIKey: FQPWWEYTNHARPU-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | [2-nitro-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | FQPWWEYTNHARPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)