cas: 601-89-8 — see every product listed under this CAS number, including other names
2-Nitrobenzene-1,3-diol (CAS 601-89-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093383-1G |
| cas | 601-89-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 299.91 Pln | |
| Fluorochem | 100g | 570.65 Pln |
| delivery time | 2-3 weeks |
|---|
2-nitrobenzene-1,3-diol (CAS 601-89-8) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 2-nitrobenzene-1,3-diol. InChIKey: ZLCPKMIJYMHZMJ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 2-nitrobenzene-1,3-diol |
| InChIKey | ZLCPKMIJYMHZMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)