cas: 5455-59-4 — see every product listed under this CAS number, including other names
2-Nitrobenzenesulfonamide 98% (CAS 5455-59-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A125850-5g |
| cas | 5455-59-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 281.38 Pln | |
| Ambeed | 500g | 871.00 Pln | |
| Ambeed | 1000g | 1310.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A125850 |
2-nitrobenzenesulfonamide (CAS 5455-59-4) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 2-nitrobenzenesulfonamide. InChIKey: GNDKYAWHEKZHPJ-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 2-nitrobenzenesulfonamide |
| InChIKey | GNDKYAWHEKZHPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)